Compound Q&A

What precautions should be taken when handling 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

Answer

2-Methoxy-5-(methylsulfonyl)benzoic acid
When handling 2-Methoxy-5-(methylsulfonyl)benzoic acid, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place and away from strong bases and reducing agents. Fume hoods should be used during handling to minimize inhalation risks. In case of spillage, the area should be cleaned up using appropriate hygiene materials, and the spill should be reported to safety personnel. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

CAS No 50390-76-6
English Name 2-Methoxy-5-(methylsulfonyl)benzoic acid
Molecular Formula C9H10O5S
Molecular Weight 230.24 g/mol
SMILES COC1=C(C=C(C=C1)S(=O)(=O)C)C(=O)O
InChIKey BXWLVQXAFBWKSR-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

2-Methoxy-5-(methylsulfonyl)benzoic acid is a white or off-white crystalline solid with a molecular ...

Compound Q&A

How is 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6) typically synthesized?

2-Methoxy-5-(methylsulfonyl)benzoic acid is typically synthesized by the reaction of 5-(methylsulfon...

Compound Q&A

What industries use 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

2-Methoxy-5-(methylsulfonyl)benzoic acid is used in various industries, including pharmaceuticals, w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...