Compound Q&A

How is 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6) typically synthesized?

Answer

2-Methoxy-5-(methylsulfonyl)benzoic acid
2-Methoxy-5-(methylsulfonyl)benzoic acid is typically synthesized by the reaction of 5-(methylsulfonyl)benzoic acid with methanol in the presence of a suitable acid catalyst, such as hydrochloric acid or sulfuric acid. The reaction involves esterification, resulting in the formation of the methyl ester derivative. The yield is generally high, with selectivity towards the desired product. The process requires careful temperature control to ensure product purity.

About

CAS No 50390-76-6
English Name 2-Methoxy-5-(methylsulfonyl)benzoic acid
Molecular Formula C9H10O5S
Molecular Weight 230.24 g/mol
SMILES COC1=C(C=C(C=C1)S(=O)(=O)C)C(=O)O
InChIKey BXWLVQXAFBWKSR-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

2-Methoxy-5-(methylsulfonyl)benzoic acid is a white or off-white crystalline solid with a molecular ...

Compound Q&A

What industries use 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

2-Methoxy-5-(methylsulfonyl)benzoic acid is used in various industries, including pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

When handling 2-Methoxy-5-(methylsulfonyl)benzoic acid, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...