Compound Q&A

What industries use 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

Answer

2-Methoxy-5-(methylsulfonyl)benzoic acid
2-Methoxy-5-(methylsulfonyl)benzoic acid is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of certain drugs. In the polymer industry, it may be used as a stabilizer or additive. Additionally, it has applications in the production of sensors and in semiconductor manufacturing, where it is used in etching processes. The compound's ability to form stable complexes with metal ions makes it valuable in these applications.

About

CAS No 50390-76-6
English Name 2-Methoxy-5-(methylsulfonyl)benzoic acid
Molecular Formula C9H10O5S
Molecular Weight 230.24 g/mol
SMILES COC1=C(C=C(C=C1)S(=O)(=O)C)C(=O)O
InChIKey BXWLVQXAFBWKSR-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

2-Methoxy-5-(methylsulfonyl)benzoic acid is a white or off-white crystalline solid with a molecular ...

Compound Q&A

How is 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6) typically synthesized?

2-Methoxy-5-(methylsulfonyl)benzoic acid is typically synthesized by the reaction of 5-(methylsulfon...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

When handling 2-Methoxy-5-(methylsulfonyl)benzoic acid, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...