Compound Q&A

What are the physical and chemical properties of 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

Answer

2-Methoxy-5-(methylsulfonyl)benzoic acid
2-Methoxy-5-(methylsulfonyl)benzoic acid is a white or off-white crystalline solid with a molecular weight of approximately 266.57 g/mol. It has a faint aromatic odor and a slightly bitter taste. The compound is soluble in organic solvents like ethanol and acetone, but less soluble in water. It exhibits weak acid properties and is reactive towards basic compounds. It is stable under normal conditions but should be stored in a cool, dry place away from strong bases and reducing agents.

About

CAS No 50390-76-6
English Name 2-Methoxy-5-(methylsulfonyl)benzoic acid
Molecular Formula C9H10O5S
Molecular Weight 230.24 g/mol
SMILES COC1=C(C=C(C=C1)S(=O)(=O)C)C(=O)O
InChIKey BXWLVQXAFBWKSR-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6) typically synthesized?

2-Methoxy-5-(methylsulfonyl)benzoic acid is typically synthesized by the reaction of 5-(methylsulfon...

Compound Q&A

What industries use 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

2-Methoxy-5-(methylsulfonyl)benzoic acid is used in various industries, including pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-5-(methylsulfonyl)benzoic acid (CAS: 50390-76-6)?

When handling 2-Methoxy-5-(methylsulfonyl)benzoic acid, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...