Compound Q&A

What industries use Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

Answer

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate
Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is primarily used in the pharmaceutical industry for the synthesis of various drug candidates. It is also utilized in the development of sensors and semiconductors due to its unique chemical properties. Additionally, it may find applications in the polymer industry, although specific uses are limited.

About

English Name Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate
Molecular Formula C12H10BrNO2S
Molecular Weight 312.19 g/mol
SMILES CCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)Br
InChIKey DXNNRQNTJYNOPB-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is a crystalline solid with a ...

Compound Q&A

How is Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) typically synthesized?

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is typically synthesized throu...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

When handling Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...