Compound Q&A

How is Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) typically synthesized?

Answer

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate
Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is typically synthesized through a multistep process involving the bromination of a phenyl group followed by coupling with 1,3-thiazole-4-carboxylic acid ethyl ester. Commonly used catalysts include thionyl chloride and triethylamine. The reaction yields a product with high selectivity and good yield, suitable for further chemical transformations.

About

English Name Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate
Molecular Formula C12H10BrNO2S
Molecular Weight 312.19 g/mol
SMILES CCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)Br
InChIKey DXNNRQNTJYNOPB-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is a crystalline solid with a ...

Compound Q&A

What industries use Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

When handling Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...