Compound Q&A

What are the physical and chemical properties of Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

Answer

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate
Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is a crystalline solid with a molecular weight of approximately 383.04 g/mol. It has low solubility in water but is soluble in organic solvents such as ethanol and acetone. This compound is moderately reactive and can undergo substitution reactions. It is stable under normal conditions but requires handling in a fume hood to prevent inhalation exposure.

About

English Name Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate
Molecular Formula C12H10BrNO2S
Molecular Weight 312.19 g/mol
SMILES CCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)Br
InChIKey DXNNRQNTJYNOPB-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) typically synthesized?

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is typically synthesized throu...

Compound Q&A

What industries use Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5)?

When handling Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS: 786654-97-5), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...