Compound Q&A

What precautions should be taken when handling Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Answer

Tert-butyl (5-bromopyrimidin-2-YL)carbamate
When handling Tert-butyl (5-bromopyrimidin-2-YL)carbamate, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dark place away from direct sunlight. It is advisable to use a fume hood during handling to minimize exposure to vapors. In case of spillage, immediately clean up the area and consult the safety data sheet (SDS) for further instructions.

About

English Name Tert-butyl (5-bromopyrimidin-2-YL)carbamate
Molecular Formula C9H12BrN3O2
Molecular Weight 274.118 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(C=N1)Br
InChIKey MQQCCIJHZDEZBW-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0) typically synthesized?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is synthesized through the reaction of tert-butyl carbam...

Compound Q&A

What industries use Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is primarily used in the pharmaceutical industry for the...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...