Compound Q&A

How is Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0) typically synthesized?

Answer

Tert-butyl (5-bromopyrimidin-2-YL)carbamate
Tert-butyl (5-bromopyrimidin-2-YL)carbamate is synthesized through the reaction of tert-butyl carbamate with 5-bromo-2-formamidopyrimidine in the presence of a suitable catalyst, such as sodium carbonate. The reaction typically yields high selectivity and a good yield, making it a reliable method for obtaining this compound in organic synthesis.

About

English Name Tert-butyl (5-bromopyrimidin-2-YL)carbamate
Molecular Formula C9H12BrN3O2
Molecular Weight 274.12 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(C=N1)Br
InChIKey MQQCCIJHZDEZBW-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is a white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

When handling Tert-butyl (5-bromopyrimidin-2-YL)carbamate, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...