Compound Q&A

What are the physical and chemical properties of Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Answer

Tert-butyl (5-bromopyrimidin-2-YL)carbamate
Tert-butyl (5-bromopyrimidin-2-YL)carbamate is a white crystalline solid with a molecular weight of approximately 260.04 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is thermally stable but may react with strong bases or acids. It shows moderate reactivity towards nucleophiles, making it a suitable reactant in various organic synthesis reactions.

About

English Name Tert-butyl (5-bromopyrimidin-2-YL)carbamate
Molecular Formula C9H12BrN3O2
Molecular Weight 274.118 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(C=N1)Br
InChIKey MQQCCIJHZDEZBW-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0) typically synthesized?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is synthesized through the reaction of tert-butyl carbam...

Compound Q&A

What industries use Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

When handling Tert-butyl (5-bromopyrimidin-2-YL)carbamate, it is essential to wear appropriate perso...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...