Compound Q&A

What industries use Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Answer

Tert-butyl (5-bromopyrimidin-2-YL)carbamate
Tert-butyl (5-bromopyrimidin-2-YL)carbamate is primarily used in the pharmaceutical industry for the synthesis of drugs. It also finds applications in the agrochemical industry as a precursor for herbicides and pesticides. Additionally, it is used in the research and development of new materials, particularly in the field of polymer science.

About

English Name Tert-butyl (5-bromopyrimidin-2-YL)carbamate
Molecular Formula C9H12BrN3O2
Molecular Weight 274.118 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(C=N1)Br
InChIKey MQQCCIJHZDEZBW-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0) typically synthesized?

Tert-butyl (5-bromopyrimidin-2-YL)carbamate is synthesized through the reaction of tert-butyl carbam...

Compound Q&A

What precautions should be taken when handling Tert-butyl (5-bromopyrimidin-2-YL)carbamate (CAS: 883231-23-0)?

When handling Tert-butyl (5-bromopyrimidin-2-YL)carbamate, it is essential to wear appropriate perso...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...