Compound Q&A

What industries use (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

Answer

(R)-3-Amino-3-(2-naphthyl)-propionic Acid
(R)-3-Amino-3-(2-naphthyl)-propionic Acid finds application in the pharmaceutical industry as a precursor in the synthesis of bioactive compounds. It is also used in the polymer industry for functionalization purposes. Additionally, it can be used in the development of sensors and as a building block in the synthesis of various organic materials.

About

English Name (R)-3-Amino-3-(2-naphthyl)-propionic Acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)C(CC(=O)O)N
InChIKey JASNXOXPNZWQRV-GFCCVEGCSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

(R)-3-Amino-3-(2-naphthyl)-propionic Acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7) typically synthesized?

(R)-3-Amino-3-(2-naphthyl)-propionic Acid can be synthesized through a multistep process involving a...

Compound Q&A

What precautions should be taken when handling (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

When handling (R)-3-Amino-3-(2-naphthyl)-propionic Acid, it is essential to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...