Compound Q&A

How is (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7) typically synthesized?

Answer

(R)-3-Amino-3-(2-naphthyl)-propionic Acid
(R)-3-Amino-3-(2-naphthyl)-propionic Acid can be synthesized through a multistep process involving acylation of 2-naphthol followed by aminoation. The synthesis typically involves the use of acetic anhydride for acylation, and hydrazine or an appropriate amine for the aminoation step. The reaction conditions include the use of a catalytic amount of a base like potassium carbonate to enhance the reaction yield and selectivity.

About

English Name (R)-3-Amino-3-(2-naphthyl)-propionic Acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)C(CC(=O)O)N
InChIKey JASNXOXPNZWQRV-GFCCVEGCSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

(R)-3-Amino-3-(2-naphthyl)-propionic Acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

(R)-3-Amino-3-(2-naphthyl)-propionic Acid finds application in the pharmaceutical industry as a prec...

Compound Q&A

What precautions should be taken when handling (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

When handling (R)-3-Amino-3-(2-naphthyl)-propionic Acid, it is essential to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...