Compound Q&A

What are the physical and chemical properties of (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

Answer

(R)-3-Amino-3-(2-naphthyl)-propionic Acid
(R)-3-Amino-3-(2-naphthyl)-propionic Acid is a white crystalline solid with a molecular weight of approximately 257.24 g/mol. It has a pKa of around 9.3 and is slightly soluble in water. The compound is known for its stability under normal conditions but can react with strong acids or bases. It is poorly soluble in organic solvents like ethanol and acetone but dissolves in more polar solvents like methanol and acetonitrile.

About

English Name (R)-3-Amino-3-(2-naphthyl)-propionic Acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)C(CC(=O)O)N
InChIKey JASNXOXPNZWQRV-GFCCVEGCSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7) typically synthesized?

(R)-3-Amino-3-(2-naphthyl)-propionic Acid can be synthesized through a multistep process involving a...

Compound Q&A

What industries use (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

(R)-3-Amino-3-(2-naphthyl)-propionic Acid finds application in the pharmaceutical industry as a prec...

Compound Q&A

What precautions should be taken when handling (R)-3-Amino-3-(2-naphthyl)-propionic Acid (CAS: 786637-72-7)?

When handling (R)-3-Amino-3-(2-naphthyl)-propionic Acid, it is essential to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...