Compound Q&A

What precautions should be taken when handling Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Answer

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate
Proper handling of Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) requires the use of personal protective equipment (PPE) such as gloves, goggles, and lab coats. The compound should be stored in a cool, dry place away from direct sunlight and flammable materials. In case of spills, they should be cleaned up immediately using appropriate absorbents and disposal methods as outlined in the Safety Data Sheet (SDS).

About

English Name Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate
Molecular Formula C20H22N2O2
Molecular Weight 311.42500000000007 g/mol
SMILES CC(C)C(C(=O)OC)NCC1=CC=C(C=C1)C2=CC=CC=C2C#N
InChIKey ZQHINOUCNQKQEV-IBGZPJMESA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is a crystalline compound wit...

Compound Q&A

How is Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) typically synthesized?

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is typically synthesized via ...

Compound Q&A

What industries use Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is primarily used in the phar...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...