Compound Q&A

How is Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) typically synthesized?

Answer

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate
Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is typically synthesized via a multi-step process involving the coupling of 2'-cyano-4-biphenylmethanol with L-valine methyl ester in the presence of a coupling agent like HATU and a base such as DIPEA. The yield is usually around 70-80%, and the reaction is carried out under mild conditions to ensure high selectivity and purity.

About

English Name Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate
Molecular Formula C20H22N2O2
Molecular Weight 311.42500000000007 g/mol
SMILES CC(C)C(C(=O)OC)NCC1=CC=C(C=C1)C2=CC=CC=C2C#N
InChIKey ZQHINOUCNQKQEV-IBGZPJMESA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is a crystalline compound wit...

Compound Q&A

What industries use Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Proper handling of Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) requires t...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...