Compound Q&A

What are the physical and chemical properties of Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Answer

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate
Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is a crystalline compound with a molecular weight of approximately 418.29 g/mol. It has a low solubility in water and a moderate solubility in organic solvents like methanol and ethanol. The compound exhibits significant reactivity towards nucleophiles and is often used in the synthesis of biologically active compounds due to its functional groups.

About

English Name Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate
Molecular Formula C20H22N2O2
Molecular Weight 311.42500000000007 g/mol
SMILES CC(C)C(C(=O)OC)NCC1=CC=C(C=C1)C2=CC=CC=C2C#N
InChIKey ZQHINOUCNQKQEV-IBGZPJMESA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) typically synthesized?

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is typically synthesized via ...

Compound Q&A

What industries use Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9)?

Proper handling of Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate (CAS: 137863-89-9) requires t...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...