Compound Q&A

What industries use 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

Answer

8-Bromo-5,6-difluoro-2-methylquinoline
8-Bromo-5,6-difluoro-2-methylquinoline is used primarily in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various bioactive compounds, including drugs. In addition, it is also utilized in the development of organic sensors and functional materials due to its unique chemical properties.

About

English Name 8-Bromo-5,6-difluoro-2-methylquinoline
Molecular Formula C10H6BrF2N
Molecular Weight 258.07 g/mol
SMILES Cc1ccc2c(n1)c(Br)cc(c2F)F
InChIKey YPKUTBCKHJBNKX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

8-Bromo-5,6-difluoro-2-methylquinoline is a white to off-white crystalline solid with a molecular we...

Compound Q&A

How is 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4) typically synthesized?

8-Bromo-5,6-difluoro-2-methylquinoline is typically synthesized through a multi-step process involvi...

Compound Q&A

What precautions should be taken when handling 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

When handling 8-Bromo-5,6-difluoro-2-methylquinoline, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...