Compound Q&A

What are the physical and chemical properties of 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

Answer

8-Bromo-5,6-difluoro-2-methylquinoline
8-Bromo-5,6-difluoro-2-methylquinoline is a white to off-white crystalline solid with a molecular weight of 251.02 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. The compound is known for its high stability but can undergo substitution reactions under appropriate conditions. It is generally reactive towards nucleophiles and electrophiles.

About

English Name 8-Bromo-5,6-difluoro-2-methylquinoline
Molecular Formula C10H6BrF2N
Molecular Weight 258.07 g/mol
SMILES Cc1ccc2c(n1)c(Br)cc(c2F)F
InChIKey YPKUTBCKHJBNKX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4) typically synthesized?

8-Bromo-5,6-difluoro-2-methylquinoline is typically synthesized through a multi-step process involvi...

Compound Q&A

What industries use 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

8-Bromo-5,6-difluoro-2-methylquinoline is used primarily in the pharmaceutical and chemical industri...

Compound Q&A

What precautions should be taken when handling 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

When handling 8-Bromo-5,6-difluoro-2-methylquinoline, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...