Compound Q&A

How is 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4) typically synthesized?

Answer

8-Bromo-5,6-difluoro-2-methylquinoline
8-Bromo-5,6-difluoro-2-methylquinoline is typically synthesized through a multi-step process involving the protection of a quinoline ring, introduction of bromine and fluorine substituents, and the subsequent deprotection. Commonly used reactions include bromination of 5,6-difluoro-2-methylquinoline followed by quenching and purification steps. The yield from these reactions can be controlled by the choice of solvents and reaction conditions.

About

English Name 8-Bromo-5,6-difluoro-2-methylquinoline
Molecular Formula C10H6BrF2N
Molecular Weight 258.07 g/mol
SMILES Cc1ccc2c(n1)c(Br)cc(c2F)F
InChIKey YPKUTBCKHJBNKX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

8-Bromo-5,6-difluoro-2-methylquinoline is a white to off-white crystalline solid with a molecular we...

Compound Q&A

What industries use 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

8-Bromo-5,6-difluoro-2-methylquinoline is used primarily in the pharmaceutical and chemical industri...

Compound Q&A

What precautions should be taken when handling 8-Bromo-5,6-difluoro-2-methylquinoline (CAS: 131190-82-4)?

When handling 8-Bromo-5,6-difluoro-2-methylquinoline, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...