Compound Q&A

What industries use Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

Answer

Methyl N-Cbz-piperidine-2-carboxylate
Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is primarily used in the pharmaceutical and fine chemical industries. It serves as a valuable intermediate in the synthesis of various drugs and bioactive molecules. Additionally, it is employed in the development of novel materials, such as sensors and semiconductors, due to its structural versatility and reactivity.

About

English Name Methyl N-Cbz-piperidine-2-carboxylate
Molecular Formula C15H19NO4
Molecular Weight 277.31 g/mol
SMILES COC(=O)C1CCCCN1C(=O)OCC2=CC=CC=C2
InChIKey PKYPKDMELOKLKL-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is a crystalline solid with a molecular wei...

Compound Q&A

How is Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) typically synthesized?

Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is commonly synthesized through the condens...

Compound Q&A

What precautions should be taken when handling Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

When handling Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...