Compound Q&A

What are the physical and chemical properties of Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

Answer

Methyl N-Cbz-piperidine-2-carboxylate
Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is a crystalline solid with a molecular weight of approximately 300.35 g/mol. It has a low solubility in water but is soluble in organic solvents such as dichloromethane and acetonitrile. Chemically, it is moderately reactive towards nucleophiles and is often used as a precursors in organic synthesis. It exhibits good stability under normal storage conditions but should be handled with caution to avoid decomposition under strong acidic or basic conditions.

About

English Name Methyl N-Cbz-piperidine-2-carboxylate
Molecular Formula C15H19NO4
Molecular Weight 277.31 g/mol
SMILES COC(=O)C1CCCCN1C(=O)OCC2=CC=CC=C2
InChIKey PKYPKDMELOKLKL-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) typically synthesized?

Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is commonly synthesized through the condens...

Compound Q&A

What industries use Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

When handling Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...