Compound Q&A

How is Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) typically synthesized?

Answer

Methyl N-Cbz-piperidine-2-carboxylate
Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is commonly synthesized through the condensation of piperidine-2-carboxylic acid with benzyl chloroformate. The reaction is typically conducted in the presence of a base such as triethylamine. The benzyl protecting group is used to facilitate further functionalization steps in synthetic routes. This method provides good yields and high regioselectivity.

About

English Name Methyl N-Cbz-piperidine-2-carboxylate
Molecular Formula C15H19NO4
Molecular Weight 277.31 g/mol
SMILES COC(=O)C1CCCCN1C(=O)OCC2=CC=CC=C2
InChIKey PKYPKDMELOKLKL-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7)?

When handling Methyl N-Cbz-piperidine-2-carboxylate (CAS: 180609-56-7), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...