Compound Q&A

What industries use 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3)?

Answer

2-Phenoxy-1-phenylethanol
2-Phenoxy-1-phenylethanol (CAS: 4249-72-3) finds application in various industries. It is used as a fragrance compound in the cosmetics and perfume industries due to its pleasant aroma. Additionally, it is utilized in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. Its chemical properties also make it suitable for applications in polymer manufacturing and as a sensor component.

About

CAS No 4249-72-3
English Name 2-Phenoxy-1-phenylethanol
Molecular Formula C14H14O2
Molecular Weight 214.26 g/mol
SMILES C1=CC=C(C=C1)C(COC2=CC=CC=C2)O
InChIKey GSBICRJXEDSPTE-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3)?

2-Phenoxy-1-phenylethanol (CAS: 4249-72-3) is a colorless liquid with a molecular weight of approxim...

Compound Q&A

How is 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3) typically synthesized?

2-Phenoxy-1-phenylethanol is commonly synthesized via the condensation of phenoxyacetaldehyde with p...

Compound Q&A

What precautions should be taken when handling 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3)?

When handling 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...