Compound Q&A

What are the physical and chemical properties of 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3)?

Answer

2-Phenoxy-1-phenylethanol
2-Phenoxy-1-phenylethanol (CAS: 4249-72-3) is a colorless liquid with a molecular weight of approximately 216.26 g/mol. It has a high boiling point of around 220°C and a density of 1.06 g/cm³. The compound is slightly soluble in water but miscible with common organic solvents. It exhibits moderate reactivity, particularly towards nucleophilic substitution reactions and can be oxidized under certain conditions.

About

CAS No 4249-72-3
English Name 2-Phenoxy-1-phenylethanol
Molecular Formula C14H14O2
Molecular Weight 214.26 g/mol
SMILES C1=CC=C(C=C1)C(COC2=CC=CC=C2)O
InChIKey GSBICRJXEDSPTE-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3) typically synthesized?

2-Phenoxy-1-phenylethanol is commonly synthesized via the condensation of phenoxyacetaldehyde with p...

Compound Q&A

What industries use 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3)?

2-Phenoxy-1-phenylethanol (CAS: 4249-72-3) finds application in various industries. It is used as a ...

Compound Q&A

What precautions should be taken when handling 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3)?

When handling 2-Phenoxy-1-phenylethanol (CAS: 4249-72-3), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...