Compound Q&A

What industries use 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

Answer

2H-Chromene-3-carboxylic acid
2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) finds applications in various industries, particularly in pharmaceuticals, where it is used as a precursor in the synthesis of drugs. It is also utilized in the production of sensors and electronic materials, as well as in the development of certain polymers and semiconductors due to its favorable electronic and structural properties.

About

CAS No 22649-28-1
English Name 2H-Chromene-3-carboxylic acid
Molecular Formula C10H8O3
Molecular Weight 176.17 g/mol
SMILES C1C(=CC2=CC=CC=C2O1)C(=O)O
InChIKey DEBZQUFVQZPPLC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) is a white crystalline solid with a molecular weight...

Compound Q&A

How is 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) typically synthesized?

2H-Chromene-3-carboxylic acid is typically synthesized via the condensation of chromone with acetic ...

Compound Q&A

What precautions should be taken when handling 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

When handling 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...