Compound Q&A

What are the physical and chemical properties of 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

Answer

2H-Chromene-3-carboxylic acid
2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) is a white crystalline solid with a molecular weight of approximately 188.14 g/mol. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. This compound is moderately reactive, particularly with bases, leading to the formation of sodium salts and other derivatives. It shows good stability under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

CAS No 22649-28-1
English Name 2H-Chromene-3-carboxylic acid
Molecular Formula C10H8O3
Molecular Weight 176.17 g/mol
SMILES C1C(=CC2=CC=CC=C2O1)C(=O)O
InChIKey DEBZQUFVQZPPLC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) typically synthesized?

2H-Chromene-3-carboxylic acid is typically synthesized via the condensation of chromone with acetic ...

Compound Q&A

What industries use 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) finds applications in various industries, particular...

Compound Q&A

What precautions should be taken when handling 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

When handling 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...