Compound Q&A

How is 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) typically synthesized?

Answer

2H-Chromene-3-carboxylic acid
2H-Chromene-3-carboxylic acid is typically synthesized via the condensation of chromone with acetic anhydride followed by acid work-up. This method provides a good yield and selectivity. Other routes include the oxidation of chromene-3-aldehyde followed by acylation with an appropriate acid chloride. Catalysts such as hydrogen peroxide and sulfuric acid are commonly used to facilitate the oxidation step.

About

CAS No 22649-28-1
English Name 2H-Chromene-3-carboxylic acid
Molecular Formula C10H8O3
Molecular Weight 176.17 g/mol
SMILES C1C(=CC2=CC=CC=C2O1)C(=O)O
InChIKey DEBZQUFVQZPPLC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) is a white crystalline solid with a molecular weight...

Compound Q&A

What industries use 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

2H-Chromene-3-carboxylic acid (CAS: 22649-28-1) finds applications in various industries, particular...

Compound Q&A

What precautions should be taken when handling 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1)?

When handling 2H-Chromene-3-carboxylic acid (CAS: 22649-28-1), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...