Compound Q&A

What industries use 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

Answer

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate
4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is used in pharmaceuticals for its potential as a precursor in drug synthesis, and in polymer science for the modification of polymer properties. It is also explored in the development of sensors and semiconductors due to its unique chemical structure.

About

English Name 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate
Molecular Formula C15H19NO5
Molecular Weight 293.31899999999996 g/mol
SMILES CCOC(=O)C1CN(CCO1)C(=O)OCc2ccccc2
InChIKey QEIFMBIQRFZCCC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is a white crystalline solid with a molecular weight of...

Compound Q&A

How is 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5) typically synthesized?

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is typically synthesized by the condensation of 2-ethyl...

Compound Q&A

What precautions should be taken when handling 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

When handling 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate, it is important to use appropriate perso...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...