Compound Q&A

What are the physical and chemical properties of 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

Answer

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate
4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is a white crystalline solid with a molecular weight of approximately 260.33 g/mol. It is moderately soluble in common organic solvents like dichloromethane and dimethylformamide. This compound is relatively stable under normal conditions but can react with strong bases or acids. Its reactivity is moderate, making it suitable for various chemical transformations.

About

English Name 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate
Molecular Formula C15H19NO5
Molecular Weight 293.31899999999996 g/mol
SMILES CCOC(=O)C1CN(CCO1)C(=O)OCc2ccccc2
InChIKey QEIFMBIQRFZCCC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5) typically synthesized?

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is typically synthesized by the condensation of 2-ethyl...

Compound Q&A

What industries use 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is used in pharmaceuticals for its potential as a precu...

Compound Q&A

What precautions should be taken when handling 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

When handling 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate, it is important to use appropriate perso...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...