Compound Q&A

How is 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5) typically synthesized?

Answer

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate
4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is typically synthesized by the condensation of 2-ethylmorpholine and benzoic acid in the presence of a catalyst like a Lewis acid. The reaction is carried out under mild conditions to ensure high selectivity and yield, with the product being isolated through recrystallization from appropriate solvents.

About

English Name 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate
Molecular Formula C15H19NO5
Molecular Weight 293.31899999999996 g/mol
SMILES CCOC(=O)C1CN(CCO1)C(=O)OCc2ccccc2
InChIKey QEIFMBIQRFZCCC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate is used in pharmaceuticals for its potential as a precu...

Compound Q&A

What precautions should be taken when handling 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate (CAS: 1226776-83-5)?

When handling 4-Benzyl 2-ethyl 2,4-morpholinedicarboxylate, it is important to use appropriate perso...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...