Compound Q&A

What precautions should be taken when handling 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

Answer

2-((5-Bromopyrimidin-2-yl)thio)acetic acid
When handling 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Work should be conducted in a well-ventilated area or fume hood. Spills should be managed using appropriate absorbent materials, and the area should be thoroughly cleaned. Always consult the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 52767-92-7
English Name 2-((5-Bromopyrimidin-2-yl)thio)acetic acid
Molecular Formula C6H5BrN2O2S
Molecular Weight 249.09 g/mol
SMILES C1=C(C=NC(=N1)SCC(=O)O)Br
InChIKey GEFXJQVEMVQMSS-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid has a crystalline form with a molecular weight of approxi...

Compound Q&A

How is 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7) typically synthesized?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid is typically synthesized through a multi-step process inv...

Compound Q&A

What industries use 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid is primarily used in pharmaceuticals for developing antiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...