Compound Q&A

How is 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7) typically synthesized?

Answer

2-((5-Bromopyrimidin-2-yl)thio)acetic acid
2-((5-Bromopyrimidin-2-yl)thio)acetic acid is typically synthesized through a multi-step process involving the bromination of pyrimidine followed by thioetherification with acetic acid. Commonly used catalysts include sulfuric acid, and the reaction is conducted under reflux conditions to achieve high yields. The product is purified through recrystallization or column chromatography.

About

CAS No 52767-92-7
English Name 2-((5-Bromopyrimidin-2-yl)thio)acetic acid
Molecular Formula C6H5BrN2O2S
Molecular Weight 249.09 g/mol
SMILES C1=C(C=NC(=N1)SCC(=O)O)Br
InChIKey GEFXJQVEMVQMSS-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid has a crystalline form with a molecular weight of approxi...

Compound Q&A

What industries use 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid is primarily used in pharmaceuticals for developing antiv...

Compound Q&A

What precautions should be taken when handling 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

When handling 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...