Compound Q&A

What are the physical and chemical properties of 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

Answer

2-((5-Bromopyrimidin-2-yl)thio)acetic acid
2-((5-Bromopyrimidin-2-yl)thio)acetic acid has a crystalline form with a molecular weight of approximately 270.02 g/mol. It is practically insoluble in water but soluble in organic solvents like DMSO and acetonitrile. Chemically, it shows moderate reactivity towards nucleophiles and can undergo substitution reactions. It is also susceptible to hydrolysis under basic conditions.

About

CAS No 52767-92-7
English Name 2-((5-Bromopyrimidin-2-yl)thio)acetic acid
Molecular Formula C6H5BrN2O2S
Molecular Weight 249.09 g/mol
SMILES C1=C(C=NC(=N1)SCC(=O)O)Br
InChIKey GEFXJQVEMVQMSS-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7) typically synthesized?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid is typically synthesized through a multi-step process inv...

Compound Q&A

What industries use 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid is primarily used in pharmaceuticals for developing antiv...

Compound Q&A

What precautions should be taken when handling 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

When handling 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...