Compound Q&A

What industries use 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

Answer

2-((5-Bromopyrimidin-2-yl)thio)acetic acid
2-((5-Bromopyrimidin-2-yl)thio)acetic acid is primarily used in pharmaceuticals for developing antiviral and anticancer drugs. It also finds applications in the synthesis of polymer additives, where its thioether functionality can improve the performance of polymer materials. Additionally, it is explored in the field of sensors for detecting specific chemical compounds.

About

CAS No 52767-92-7
English Name 2-((5-Bromopyrimidin-2-yl)thio)acetic acid
Molecular Formula C6H5BrN2O2S
Molecular Weight 249.09 g/mol
SMILES C1=C(C=NC(=N1)SCC(=O)O)Br
InChIKey GEFXJQVEMVQMSS-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid has a crystalline form with a molecular weight of approxi...

Compound Q&A

How is 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7) typically synthesized?

2-((5-Bromopyrimidin-2-yl)thio)acetic acid is typically synthesized through a multi-step process inv...

Compound Q&A

What precautions should be taken when handling 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7)?

When handling 2-((5-Bromopyrimidin-2-yl)thio)acetic acid (CAS: 52767-92-7), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...