Compound Q&A

What industries use 1-(4-Nitrophenyl)pyrrolidine (CAS: 10220-22-1)?

Answer

1-(4-Nitrophenyl)pyrrolidine
1-(4-Nitrophenyl)pyrrolidine is used in various industries, including pharmaceuticals for its potential as a precursor in drug synthesis, and in polymer chemistry for the modification of polymers. It is also relevant in the semiconductor industry for its use in the fabrication of certain materials.

About

CAS No 10220-22-1
English Name 1-(4-Nitrophenyl)pyrrolidine
Molecular Formula C10H12N2O2
Molecular Weight 192.21 g/mol
SMILES C1CCN(C1)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey IXQSJUBRGIJRCV-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)pyrrolidine (CAS: 10220-22-1)?

1-(4-Nitrophenyl)pyrrolidine is a white crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 1-(4-Nitrophenyl)pyrrolidine (CAS: 10220-22-1) typically synthesized?

1-(4-Nitrophenyl)pyrrolidine can be synthesized by reacting 4-nitrophenol with pyrrolidine in the pr...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)pyrrolidine (CAS: 10220-22-1)?

When handling 1-(4-Nitrophenyl)pyrrolidine, it is essential to use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...