Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)pyrrolidine (CAS: 10220-22-1)?

Answer

1-(4-Nitrophenyl)pyrrolidine
1-(4-Nitrophenyl)pyrrolidine is a white crystalline solid with a molecular weight of approximately 214.11 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it is a reactive compound, particularly susceptible to reduction and nitro group substitution reactions.

About

CAS No 10220-22-1
English Name 1-(4-Nitrophenyl)pyrrolidine
Molecular Formula C10H12N2O2
Molecular Weight 192.21 g/mol
SMILES C1CCN(C1)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey IXQSJUBRGIJRCV-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 1-(4-Nitrophenyl)pyrrolidine (CAS: 10220-22-1) typically synthesized?

1-(4-Nitrophenyl)pyrrolidine can be synthesized by reacting 4-nitrophenol with pyrrolidine in the pr...

Compound Q&A

What industries use 1-(4-Nitrophenyl)pyrrolidine (CAS: 10220-22-1)?

1-(4-Nitrophenyl)pyrrolidine is used in various industries, including pharmaceuticals for its potent...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)pyrrolidine (CAS: 10220-22-1)?

When handling 1-(4-Nitrophenyl)pyrrolidine, it is essential to use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...