Compound Q&A

What industries use 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

Answer

3-Amino-3-(4-hydroxyphenyl)propanoic acid
3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) is primarily used in pharmaceuticals as an intermediate for the synthesis of various biologically active compounds. It is also used in the production of polymers and in some analytical applications as a chromophore or fluorophore. Additionally, it has potential applications in sensors and semiconductors due to its aromatic nature.

About

CAS No 6049-54-3
English Name 3-Amino-3-(4-hydroxyphenyl)propanoic acid
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)O)N)O
InChIKey JYPHNHPXFNEZBR-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) is a white to off-white crystalline solid...

Compound Q&A

How is 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) typically synthesized?

3-Amino-3-(4-hydroxyphenyl)propanoic acid is typically synthesized through the coupling of 4-hydroxy...

Compound Q&A

What precautions should be taken when handling 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

When handling 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3), proper personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...