Compound Q&A

How is 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) typically synthesized?

Answer

3-Amino-3-(4-hydroxyphenyl)propanoic acid
3-Amino-3-(4-hydroxyphenyl)propanoic acid is typically synthesized through the coupling of 4-hydroxybenzaldehyde with alanine. The reaction involves the condensation of these two molecules in the presence of a suitable catalyst such as p-toluene sulfonic acid (p-TSA) or other Lewis acids. The yield is generally good with selectivity towards the desired diastereomer. The reaction is carried out in aqueous media, and the product can be isolated by recrystallization.

About

CAS No 6049-54-3
English Name 3-Amino-3-(4-hydroxyphenyl)propanoic acid
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)O)N)O
InChIKey JYPHNHPXFNEZBR-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) is a white to off-white crystalline solid...

Compound Q&A

What industries use 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) is primarily used in pharmaceuticals as a...

Compound Q&A

What precautions should be taken when handling 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

When handling 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3), proper personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...