Compound Q&A

What are the physical and chemical properties of 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

Answer

3-Amino-3-(4-hydroxyphenyl)propanoic acid
3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) is a white to off-white crystalline solid with a molecular weight of approximately 221.22 g/mol. It has a pKa of about 4.2 in aqueous solution and is slightly soluble in water. It is reactive towards bases and can form salts. Common solvents include ethanol and methanol. It is also stable under normal storage conditions, but care should be taken to avoid strong acids and oxidizing agents.

About

CAS No 6049-54-3
English Name 3-Amino-3-(4-hydroxyphenyl)propanoic acid
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)O)N)O
InChIKey JYPHNHPXFNEZBR-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) typically synthesized?

3-Amino-3-(4-hydroxyphenyl)propanoic acid is typically synthesized through the coupling of 4-hydroxy...

Compound Q&A

What industries use 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3) is primarily used in pharmaceuticals as a...

Compound Q&A

What precautions should be taken when handling 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3)?

When handling 3-Amino-3-(4-hydroxyphenyl)propanoic acid (CAS: 6049-54-3), proper personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...