Compound Q&A

What precautions should be taken when handling (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

Answer

(3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid
When handling (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0), it is important to use proper protective equipment such as gloves, goggles, and a lab coat. The substance should be stored in a cool, dry place away from moisture. Spills should be cleaned up using appropriate procedures and personal protective equipment. An SDS should be consulted for detailed safety information.

About

CAS No 83509-88-0
English Name (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES C[C@@H](CC(=O)O)NC(=O)OCc1ccccc1
InChIKey HYWJKPFAIAWVHP-VIFPVBQESA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is a white crystalli...

Compound Q&A

How is (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) typically synthesized?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is typically synthes...

Compound Q&A

What industries use (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is primarily used in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...