Compound Q&A

How is (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) typically synthesized?

Answer

(3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid
The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is typically synthesized by the coupling of benzyloxycarbonyl chloride with aminobutanoic acid. Commonly used catalysts include triethylamine and HOBt. The reaction is carried out in anhydrous organic solvents such as dichloromethane under anhydrous conditions to achieve high yield and selectivity.

About

CAS No 83509-88-0
English Name (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES C[C@@H](CC(=O)O)NC(=O)OCc1ccccc1
InChIKey HYWJKPFAIAWVHP-VIFPVBQESA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is a white crystalli...

Compound Q&A

What industries use (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is primarily used in...

Compound Q&A

What precautions should be taken when handling (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

When handling (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...