Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

Answer

(3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid
The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is a white crystalline solid with a molecular weight of approximately 284.27 g/mol. It has a pKa of about 8.7 in aqueous solutions and is slightly soluble in water. Chemically, it can undergo esterification and amide formation. It is reactive under basic conditions and can be used in peptide synthesis.

About

CAS No 83509-88-0
English Name (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES C[C@@H](CC(=O)O)NC(=O)OCc1ccccc1
InChIKey HYWJKPFAIAWVHP-VIFPVBQESA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) typically synthesized?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is typically synthes...

Compound Q&A

What industries use (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is primarily used in...

Compound Q&A

What precautions should be taken when handling (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

When handling (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...