Compound Q&A

What industries use (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

Answer

(3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid
The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is primarily used in the pharmaceutical industry for the synthesis of peptides and proteins. It is also used in the polymer industry for the development of biodegradable polymers and in the sensor industry for the creation of sensitive detection devices.

About

CAS No 83509-88-0
English Name (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES C[C@@H](CC(=O)O)NC(=O)OCc1ccccc1
InChIKey HYWJKPFAIAWVHP-VIFPVBQESA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is a white crystalli...

Compound Q&A

How is (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) typically synthesized?

The compound (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0) is typically synthes...

Compound Q&A

What precautions should be taken when handling (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0)?

When handling (3S)-3-{[(Benzyloxy)carbonyl]amino}butanoic acid (CAS: 83509-88-0), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...