Compound Q&A

What precautions should be taken when handling 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

Answer

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1)
When handling 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1), it is essential to wear personal protective equipment (PPE) such as gloves and safety goggles. Work should be conducted in a fume hood to minimize exposure to the compound. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and storage information. Proper disposal of waste should follow local regulations to ensure environmental safety.

About

English Name 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1)
Molecular Formula C20H27AuClP
Molecular Weight 530.82 g/mol
SMILES CC(P(C1=CC=CC=C1C2=CC=CC=C2)C(C)(C)C)(C)C.[Au+].[Cl-]
InChIKey MZMOUYZCJIFYAH-UHFFFAOYSA-M
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is a solid compound with a molecu...

Compound Q&A

How is 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5) typically synthesized?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is typically synthesized by the r...

Compound Q&A

What industries use 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is used in various industries due...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...