Compound Q&A

What industries use 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

Answer

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1)
2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is used in various industries due to its catalytic properties. It is particularly useful in the pharmaceutical industry for catalytic reductions and cross-coupling reactions. In the semiconductor industry, it serves as a precursor for gold-based materials. Additionally, it finds applications in the production of sensors and as a ligand in organometallic chemistry.

About

English Name 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1)
Molecular Formula C20H27AuClP
Molecular Weight 530.82 g/mol
SMILES CC(P(C1=CC=CC=C1C2=CC=CC=C2)C(C)(C)C)(C)C.[Au+].[Cl-]
InChIKey MZMOUYZCJIFYAH-UHFFFAOYSA-M
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is a solid compound with a molecu...

Compound Q&A

How is 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5) typically synthesized?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is typically synthesized by the r...

Compound Q&A

What precautions should be taken when handling 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

When handling 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...