Compound Q&A

What are the physical and chemical properties of 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

Answer

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1)
2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is a solid compound with a molecular weight of approximately 671.95 g/mol. It has a low solubility in common organic solvents but is soluble in water. The compound is known for its catalytic activity and reactivity towards various substrates. It forms crystalline structures under appropriate conditions, and its reactivity is influenced by the presence of gold and phosphine ligands.

About

English Name 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1)
Molecular Formula C20H27AuClP
Molecular Weight 530.82 g/mol
SMILES CC(P(C1=CC=CC=C1C2=CC=CC=C2)C(C)(C)C)(C)C.[Au+].[Cl-]
InChIKey MZMOUYZCJIFYAH-UHFFFAOYSA-M
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5) typically synthesized?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is typically synthesized by the r...

Compound Q&A

What industries use 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is used in various industries due...

Compound Q&A

What precautions should be taken when handling 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

When handling 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...