Compound Q&A

How is 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5) typically synthesized?

Answer

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1)
2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is typically synthesized by the reaction of chlorogold with 2-biphenylyl[bis(2-methyl-2-propanyl)]phosphine. The synthesis involves the use of gold(III) chloride and the phosphine as starting materials. The reaction is carried out under inert conditions to avoid oxidation. The yield and selectivity of the reaction can be optimized by controlling the reaction temperature and the stoichiometry of reactants.

About

English Name 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1)
Molecular Formula C20H27AuClP
Molecular Weight 530.82 g/mol
SMILES CC(P(C1=CC=CC=C1C2=CC=CC=C2)C(C)(C)C)(C)C.[Au+].[Cl-]
InChIKey MZMOUYZCJIFYAH-UHFFFAOYSA-M
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is a solid compound with a molecu...

Compound Q&A

What industries use 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) is used in various industries due...

Compound Q&A

What precautions should be taken when handling 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1) (CAS: 854045-93-5)?

When handling 2-Biphenylyl[bis(2-methyl-2-propanyl)]phosphine - chlorogold (1:1), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...