Compound Q&A

What precautions should be taken when handling 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

Answer

2,3-Dihydro-1-benzofuran-7-ylboronic acid
When handling 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up promptly using appropriate absorbent materials. For detailed safety information, consult the Material Safety Data Sheet (MSDS/SDS).

About

English Name 2,3-Dihydro-1-benzofuran-7-ylboronic acid
Molecular Formula C8H9BO3
Molecular Weight 163.97 g/mol
SMILES B(C1=C2C(=CC=C1)CCO2)(O)O
InChIKey JDOYUFYZFXCQJP-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

2,3-Dihydro-1-benzofuran-7-ylboronic acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8) typically synthesized?

2,3-Dihydro-1-benzofuran-7-ylboronic acid is typically synthesized through the boronation of 2,3-dih...

Compound Q&A

What industries use 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

2,3-Dihydro-1-benzofuran-7-ylboronic acid is utilized in the pharmaceutical industry for the synthes...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...