Compound Q&A

What industries use 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

Answer

2,3-Dihydro-1-benzofuran-7-ylboronic acid
2,3-Dihydro-1-benzofuran-7-ylboronic acid is utilized in the pharmaceutical industry for the synthesis of various drug precursors and intermediates. It is also used in the polymer industry for the development of novel polymer materials. Additionally, this compound has applications in the development of sensors and semiconductors due to its unique chemical structure and reactivity.

About

English Name 2,3-Dihydro-1-benzofuran-7-ylboronic acid
Molecular Formula C8H9BO3
Molecular Weight 163.97 g/mol
SMILES B(C1=C2C(=CC=C1)CCO2)(O)O
InChIKey JDOYUFYZFXCQJP-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

2,3-Dihydro-1-benzofuran-7-ylboronic acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8) typically synthesized?

2,3-Dihydro-1-benzofuran-7-ylboronic acid is typically synthesized through the boronation of 2,3-dih...

Compound Q&A

What precautions should be taken when handling 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

When handling 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...